About (3-carbamoylphenyl) 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)propanoate
(3-carbamoylphenyl) 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)propanoate (PubChem CID 55642932) has the molecular formula C24H31N5O5
and a molecular weight of 469.54 g/mol. Its IUPAC name is (3-carbamoylphenyl) 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)propanoate.
Molecular Properties
| Compound Name | (3-carbamoylphenyl) 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)propanoate |
| PubChem CID | 55642932 |
| Molecular Formula | C24H31N5O5 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | (3-carbamoylphenyl) 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)propanoate |
| SMILES | CCCCCn1c(CCC(=O)Oc2cccc(C(N)=O)c2)nc2c1c(=O)[nH]c(=O)n2CCCC |
| InChI | InChI=1S/C24H31N5O5/c1-3-5-7-14-28-18(11-12-19(30)34-17-10-8-9-16(15-17)21(25)31)26-22-20(28)23(32)27-24(33)29(22)13-6-4-2/h8-10,15H,3-7,11-14H2,1-2H3,(H2,25,31)(H,27,32,33) |
| InChIKey | ZSLQWDUQCHDICG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 142.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-carbamoylphenyl) 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-carbamoylphenyl) 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)propanoate?
The IUPAC name of (3-carbamoylphenyl) 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)propanoate (CID 55642932) is (3-carbamoylphenyl) 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)propanoate.
What is the SMILES notation for (3-carbamoylphenyl) 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)propanoate?
The canonical SMILES for (3-carbamoylphenyl) 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)propanoate is CCCCCn1c(CCC(=O)Oc2cccc(C(N)=O)c2)nc2c1c(=O)[nH]c(=O)n2CCCC.
What is the InChIKey of (3-carbamoylphenyl) 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)propanoate?
The InChIKey is ZSLQWDUQCHDICG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31N5O5/c1-3-5-7-14-28-18(11-12-19(30)34-17-10-8-9-16(15-17)21(25)31)26-22-20(28)23(32)27-24(33)29(22)13-6-4-2/h8-10,15H,3-7,11-14H2,1-2H3,(H2,25,31)(H,27,32,33).
What are the key properties of (3-carbamoylphenyl) 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)propanoate?
(3-carbamoylphenyl) 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)propanoate has a molecular weight of 469.54 g/mol, XLogP of 2.51, 12 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (3-carbamoylphenyl) 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)propanoate is sourced from PubChem (CID 55642932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).