About tricyclo[5.3.1.04,9]undeca-2,5-diene
tricyclo[5.3.1.04,9]undeca-2,5-diene (PubChem CID 556439) has the molecular formula C11H14
and a molecular weight of 146.23 g/mol. Its IUPAC name is tricyclo[5.3.1.04,9]undeca-2,5-diene.
Molecular Properties
| Compound Name | tricyclo[5.3.1.04,9]undeca-2,5-diene |
| PubChem CID | 556439 |
| Molecular Formula | C11H14 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | tricyclo[5.3.1.04,9]undeca-2,5-diene |
| SMILES | C1=CC2C=CC3CC1CC2C3 |
| InChI | InChI=1S/C11H14/c1-3-10-4-2-9-5-8(1)6-11(10)7-9/h1-4,8-11H,5-7H2 |
| InChIKey | XGXAULPCJNRIKG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tricyclo[5.3.1.04,9]undeca-2,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[5.3.1.04,9]undeca-2,5-diene?
The IUPAC name of tricyclo[5.3.1.04,9]undeca-2,5-diene (CID 556439) is tricyclo[5.3.1.04,9]undeca-2,5-diene.
What is the SMILES notation for tricyclo[5.3.1.04,9]undeca-2,5-diene?
The canonical SMILES for tricyclo[5.3.1.04,9]undeca-2,5-diene is C1=CC2C=CC3CC1CC2C3.
What is the InChIKey of tricyclo[5.3.1.04,9]undeca-2,5-diene?
The InChIKey is XGXAULPCJNRIKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14/c1-3-10-4-2-9-5-8(1)6-11(10)7-9/h1-4,8-11H,5-7H2.
What are the key properties of tricyclo[5.3.1.04,9]undeca-2,5-diene?
tricyclo[5.3.1.04,9]undeca-2,5-diene has a molecular weight of 146.23 g/mol, XLogP of 2.77, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[5.3.1.04,9]undeca-2,5-diene is sourced from PubChem (CID 556439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).