C19H22N4S2 — CID 55648504
4-[(5-benzyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-2-propyl-1,3-thiazole (PubChem CID 55648504) has the molecular formula C19H22N4S2 and a molecular weight of 370.55 g/mol. Its IUPAC name is 4-[(5-benzyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-2-propyl-1,3-thiazole.
| Compound Name | 4-[(5-benzyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-2-propyl-1,3-thiazole |
|---|---|
| PubChem CID | 55648504 |
| Molecular Formula | C19H22N4S2 |
| Molecular Weight | 370.55 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 4-[(5-benzyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-2-propyl-1,3-thiazole |
| SMILES | C=CCn1c(Cc2ccccc2)nnc1SCc1csc(CCC)n1 |
| InChI | InChI=1S/C19H22N4S2/c1-3-8-18-20-16(13-24-18)14-25-19-22-21-17(23(19)11-4-2)12-15-9-6-5-7-10-15/h4-7,9-10,13H,2-3,8,11-12,14H2,1H3 |
| InChIKey | UDQOIDSLTDUPIK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|