C20H29ClFN3O — CID 55648630
2-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-1-(2-ethylpiperidin-1-yl)ethanone (PubChem CID 55648630) has the molecular formula C20H29ClFN3O and a molecular weight of 381.92 g/mol. Its IUPAC name is 2-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-1-(2-ethylpiperidin-1-yl)ethanone.
| Compound Name | 2-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-1-(2-ethylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 55648630 |
| Molecular Formula | C20H29ClFN3O |
| Molecular Weight | 381.92 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 2-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-1-(2-ethylpiperidin-1-yl)ethanone |
| SMILES | CCC1CCCCN1C(=O)CN1CCN(Cc2ccc(F)cc2Cl)CC1 |
| InChI | InChI=1S/C20H29ClFN3O/c1-2-18-5-3-4-8-25(18)20(26)15-24-11-9-23(10-12-24)14-16-6-7-17(22)13-19(16)21/h6-7,13,18H,2-5,8-12,14-15H2,1H3 |
| InChIKey | MGIANIQDNIGCQK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.92 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |