C18H24N2O — CID 55648727
5-(azocan-1-ylmethyl)-3-(4-methylphenyl)-1,2-oxazole (PubChem CID 55648727) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 5-(azocan-1-ylmethyl)-3-(4-methylphenyl)-1,2-oxazole.
| Compound Name | 5-(azocan-1-ylmethyl)-3-(4-methylphenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 55648727 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 5-(azocan-1-ylmethyl)-3-(4-methylphenyl)-1,2-oxazole |
| SMILES | Cc1ccc(-c2cc(CN3CCCCCCC3)on2)cc1 |
| InChI | InChI=1S/C18H24N2O/c1-15-7-9-16(10-8-15)18-13-17(21-19-18)14-20-11-5-3-2-4-6-12-20/h7-10,13H,2-6,11-12,14H2,1H3 |
| InChIKey | NQPPKWMTWALRTA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |