C28H36N4O2 — CID 55650442
N-[3-(1H-indol-3-yl)-1-[methyl-[(4-piperidin-1-ylphenyl)methyl]amino]-1-oxopropan-2-yl]-2-methylpropanamide (PubChem CID 55650442) has the molecular formula C28H36N4O2 and a molecular weight of 460.62 g/mol. Its IUPAC name is N-[3-(1H-indol-3-yl)-1-[methyl-[(4-piperidin-1-ylphenyl)methyl]amino]-1-oxopropan-2-yl]-2-methylpropanamide.
| Compound Name | N-[3-(1H-indol-3-yl)-1-[methyl-[(4-piperidin-1-ylphenyl)methyl]amino]-1-oxopropan-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 55650442 |
| Molecular Formula | C28H36N4O2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | N-[3-(1H-indol-3-yl)-1-[methyl-[(4-piperidin-1-ylphenyl)methyl]amino]-1-oxopropan-2-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)N(C)Cc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C28H36N4O2/c1-20(2)27(33)30-26(17-22-18-29-25-10-6-5-9-24(22)25)28(34)31(3)19-21-11-13-23(14-12-21)32-15-7-4-8-16-32/h5-6,9-14,18,20,26,29H,4,7-8,15-17,19H2,1-3H3,(H,30,33) |
| InChIKey | WQOIQIBMERRORI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|