About 8-ethenyl-9-oxatricyclo[5.2.1.04,8]dec-2-ene
8-ethenyl-9-oxatricyclo[5.2.1.04,8]dec-2-ene (PubChem CID 556514) has the molecular formula C11H14O
and a molecular weight of 162.23 g/mol. Its IUPAC name is 8-ethenyl-9-oxatricyclo[5.2.1.04,8]dec-2-ene.
Molecular Properties
| Compound Name | 8-ethenyl-9-oxatricyclo[5.2.1.04,8]dec-2-ene |
| PubChem CID | 556514 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 8-ethenyl-9-oxatricyclo[5.2.1.04,8]dec-2-ene |
| SMILES | C=CC12OC3C=CC1CCC2C3 |
| InChI | InChI=1S/C11H14O/c1-2-11-8-3-4-9(11)7-10(12-11)6-5-8/h2,5-6,8-10H,1,3-4,7H2 |
| InChIKey | POMXCZHOLNGGGA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-ethenyl-9-oxatricyclo[5.2.1.04,8]dec-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethenyl-9-oxatricyclo[5.2.1.04,8]dec-2-ene?
The IUPAC name of 8-ethenyl-9-oxatricyclo[5.2.1.04,8]dec-2-ene (CID 556514) is 8-ethenyl-9-oxatricyclo[5.2.1.04,8]dec-2-ene.
What is the SMILES notation for 8-ethenyl-9-oxatricyclo[5.2.1.04,8]dec-2-ene?
The canonical SMILES for 8-ethenyl-9-oxatricyclo[5.2.1.04,8]dec-2-ene is C=CC12OC3C=CC1CCC2C3.
What is the InChIKey of 8-ethenyl-9-oxatricyclo[5.2.1.04,8]dec-2-ene?
The InChIKey is POMXCZHOLNGGGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O/c1-2-11-8-3-4-9(11)7-10(12-11)6-5-8/h2,5-6,8-10H,1,3-4,7H2.
What are the key properties of 8-ethenyl-9-oxatricyclo[5.2.1.04,8]dec-2-ene?
8-ethenyl-9-oxatricyclo[5.2.1.04,8]dec-2-ene has a molecular weight of 162.23 g/mol, XLogP of 2.30, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethenyl-9-oxatricyclo[5.2.1.04,8]dec-2-ene is sourced from PubChem (CID 556514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).