C22H29N3O7S — CID 55654585
tert-butyl N-[2-methoxy-5-[[3-(2-methoxyethylsulfamoyl)benzoyl]amino]phenyl]carbamate (PubChem CID 55654585) has the molecular formula C22H29N3O7S and a molecular weight of 479.56 g/mol. Its IUPAC name is tert-butyl N-[2-methoxy-5-[[3-(2-methoxyethylsulfamoyl)benzoyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-methoxy-5-[[3-(2-methoxyethylsulfamoyl)benzoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 55654585 |
| Molecular Formula | C22H29N3O7S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | tert-butyl N-[2-methoxy-5-[[3-(2-methoxyethylsulfamoyl)benzoyl]amino]phenyl]carbamate |
| SMILES | COCCNS(=O)(=O)c1cccc(C(=O)Nc2ccc(OC)c(NC(=O)OC(C)(C)C)c2)c1 |
| InChI | InChI=1S/C22H29N3O7S/c1-22(2,3)32-21(27)25-18-14-16(9-10-19(18)31-5)24-20(26)15-7-6-8-17(13-15)33(28,29)23-11-12-30-4/h6-10,13-14,23H,11-12H2,1-5H3,(H,24,26)(H,25,27) |
| InChIKey | MJQSDHAKKDFLFT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|