C18H27BrN2O4 — CID 55655114
ethyl N-[1-[2-(4-bromophenoxy)propanoylamino]-4-methylpentan-2-yl]carbamate (PubChem CID 55655114) has the molecular formula C18H27BrN2O4 and a molecular weight of 415.33 g/mol. Its IUPAC name is ethyl N-[1-[2-(4-bromophenoxy)propanoylamino]-4-methylpentan-2-yl]carbamate.
| Compound Name | ethyl N-[1-[2-(4-bromophenoxy)propanoylamino]-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 55655114 |
| Molecular Formula | C18H27BrN2O4 |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | ethyl N-[1-[2-(4-bromophenoxy)propanoylamino]-4-methylpentan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(CNC(=O)C(C)Oc1ccc(Br)cc1)CC(C)C |
| InChI | InChI=1S/C18H27BrN2O4/c1-5-24-18(23)21-15(10-12(2)3)11-20-17(22)13(4)25-16-8-6-14(19)7-9-16/h6-9,12-13,15H,5,10-11H2,1-4H3,(H,20,22)(H,21,23) |
| InChIKey | GDIBCKKEEHPKCU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |