C17H21N3O3S2 — CID 55655127
(2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazol-8-yl)-(3-ethylpiperidin-1-yl)methanone (PubChem CID 55655127) has the molecular formula C17H21N3O3S2 and a molecular weight of 379.51 g/mol. Its IUPAC name is (2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazol-8-yl)-(3-ethylpiperidin-1-yl)methanone.
| Compound Name | (2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazol-8-yl)-(3-ethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 55655127 |
| Molecular Formula | C17H21N3O3S2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | (2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazol-8-yl)-(3-ethylpiperidin-1-yl)methanone |
| SMILES | CCC1CCCN(C(=O)c2ccc3c(c2)SC2=NS(=O)(=O)CCN23)C1 |
| InChI | InChI=1S/C17H21N3O3S2/c1-2-12-4-3-7-19(11-12)16(21)13-5-6-14-15(10-13)24-17-18-25(22,23)9-8-20(14)17/h5-6,10,12H,2-4,7-9,11H2,1H3 |
| InChIKey | KZGJGNWDEMLJDS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |