C22H25N3O5 — CID 55655729
N-[3-[[3-[2-(ethylamino)-2-oxoethoxy]phenyl]carbamoyl]phenyl]oxolane-2-carboxamide (PubChem CID 55655729) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is N-[3-[[3-[2-(ethylamino)-2-oxoethoxy]phenyl]carbamoyl]phenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[[3-[2-(ethylamino)-2-oxoethoxy]phenyl]carbamoyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 55655729 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | N-[3-[[3-[2-(ethylamino)-2-oxoethoxy]phenyl]carbamoyl]phenyl]oxolane-2-carboxamide |
| SMILES | CCNC(=O)COc1cccc(NC(=O)c2cccc(NC(=O)C3CCCO3)c2)c1 |
| InChI | InChI=1S/C22H25N3O5/c1-2-23-20(26)14-30-18-9-4-8-17(13-18)24-21(27)15-6-3-7-16(12-15)25-22(28)19-10-5-11-29-19/h3-4,6-9,12-13,19H,2,5,10-11,14H2,1H3,(H,23,26)(H,24,27)(H,25,28) |
| InChIKey | GMZKOJSTNLFLRC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |