About (4-propan-2-ylcyclohexa-1,3-dien-1-yl)methanol
(4-propan-2-ylcyclohexa-1,3-dien-1-yl)methanol (PubChem CID 556567) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is (4-propan-2-ylcyclohexa-1,3-dien-1-yl)methanol.
Molecular Properties
| Compound Name | (4-propan-2-ylcyclohexa-1,3-dien-1-yl)methanol |
| PubChem CID | 556567 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (4-propan-2-ylcyclohexa-1,3-dien-1-yl)methanol |
| SMILES | CC(C)C1=CC=C(CO)CC1 |
| InChI | InChI=1S/C10H16O/c1-8(2)10-5-3-9(7-11)4-6-10/h3,5,8,11H,4,6-7H2,1-2H3 |
| InChIKey | HBKLKBUNCSHWKO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4-propan-2-ylcyclohexa-1,3-dien-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-propan-2-ylcyclohexa-1,3-dien-1-yl)methanol?
The IUPAC name of (4-propan-2-ylcyclohexa-1,3-dien-1-yl)methanol (CID 556567) is (4-propan-2-ylcyclohexa-1,3-dien-1-yl)methanol.
What is the SMILES notation for (4-propan-2-ylcyclohexa-1,3-dien-1-yl)methanol?
The canonical SMILES for (4-propan-2-ylcyclohexa-1,3-dien-1-yl)methanol is CC(C)C1=CC=C(CO)CC1.
What is the InChIKey of (4-propan-2-ylcyclohexa-1,3-dien-1-yl)methanol?
The InChIKey is HBKLKBUNCSHWKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O/c1-8(2)10-5-3-9(7-11)4-6-10/h3,5,8,11H,4,6-7H2,1-2H3.
What are the key properties of (4-propan-2-ylcyclohexa-1,3-dien-1-yl)methanol?
(4-propan-2-ylcyclohexa-1,3-dien-1-yl)methanol has a molecular weight of 152.24 g/mol, XLogP of 2.28, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-propan-2-ylcyclohexa-1,3-dien-1-yl)methanol is sourced from PubChem (CID 556567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).