C24H31N5O — CID 55657060
1,6-di(propan-2-yl)-N-[(4-pyrrolidin-1-ylphenyl)methyl]pyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 55657060) has the molecular formula C24H31N5O and a molecular weight of 405.55 g/mol. Its IUPAC name is 1,6-di(propan-2-yl)-N-[(4-pyrrolidin-1-ylphenyl)methyl]pyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | 1,6-di(propan-2-yl)-N-[(4-pyrrolidin-1-ylphenyl)methyl]pyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 55657060 |
| Molecular Formula | C24H31N5O |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | 1,6-di(propan-2-yl)-N-[(4-pyrrolidin-1-ylphenyl)methyl]pyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | CC(C)c1cc(C(=O)NCc2ccc(N3CCCC3)cc2)c2cnn(C(C)C)c2n1 |
| InChI | InChI=1S/C24H31N5O/c1-16(2)22-13-20(21-15-26-29(17(3)4)23(21)27-22)24(30)25-14-18-7-9-19(10-8-18)28-11-5-6-12-28/h7-10,13,15-17H,5-6,11-12,14H2,1-4H3,(H,25,30) |
| InChIKey | OJIJAAGVEUBUEF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|