C26H29N3O5S — CID 55657800
5-[(4-methoxyphenyl)sulfamoyl]-2-methyl-N-[1-[4-(propanoylamino)phenyl]ethyl]benzamide (PubChem CID 55657800) has the molecular formula C26H29N3O5S and a molecular weight of 495.60 g/mol. Its IUPAC name is 5-[(4-methoxyphenyl)sulfamoyl]-2-methyl-N-[1-[4-(propanoylamino)phenyl]ethyl]benzamide.
| Compound Name | 5-[(4-methoxyphenyl)sulfamoyl]-2-methyl-N-[1-[4-(propanoylamino)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 55657800 |
| Molecular Formula | C26H29N3O5S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 5-[(4-methoxyphenyl)sulfamoyl]-2-methyl-N-[1-[4-(propanoylamino)phenyl]ethyl]benzamide |
| SMILES | CCC(=O)Nc1ccc(C(C)NC(=O)c2cc(S(=O)(=O)Nc3ccc(OC)cc3)ccc2C)cc1 |
| InChI | InChI=1S/C26H29N3O5S/c1-5-25(30)28-20-9-7-19(8-10-20)18(3)27-26(31)24-16-23(15-6-17(24)2)35(32,33)29-21-11-13-22(34-4)14-12-21/h6-16,18,29H,5H2,1-4H3,(H,27,31)(H,28,30) |
| InChIKey | WAPWLQDPNIRAQV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |