C21H25N3O4S2 — CID 55658237
2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-[4-(2-methoxyethoxy)phenyl]propanamide (PubChem CID 55658237) has the molecular formula C21H25N3O4S2 and a molecular weight of 447.58 g/mol. Its IUPAC name is 2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-[4-(2-methoxyethoxy)phenyl]propanamide.
| Compound Name | 2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-[4-(2-methoxyethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 55658237 |
| Molecular Formula | C21H25N3O4S2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-[4-(2-methoxyethoxy)phenyl]propanamide |
| SMILES | COCCOc1ccc(NC(=O)C(C)SCc2nc3sc(C)c(C)c3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C21H25N3O4S2/c1-12-13(2)30-21-18(12)20(26)23-17(24-21)11-29-14(3)19(25)22-15-5-7-16(8-6-15)28-10-9-27-4/h5-8,14H,9-11H2,1-4H3,(H,22,25)(H,23,24,26) |
| InChIKey | SKGYTXJHIDTDQU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|