C23H22ClN3O4S — CID 55659262
N-[2-[[3-(benzylsulfamoyl)benzoyl]amino]ethyl]-2-chlorobenzamide (PubChem CID 55659262) has the molecular formula C23H22ClN3O4S and a molecular weight of 471.97 g/mol. Its IUPAC name is N-[2-[[3-(benzylsulfamoyl)benzoyl]amino]ethyl]-2-chlorobenzamide.
| Compound Name | N-[2-[[3-(benzylsulfamoyl)benzoyl]amino]ethyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 55659262 |
| Molecular Formula | C23H22ClN3O4S |
| Molecular Weight | 471.97 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | N-[2-[[3-(benzylsulfamoyl)benzoyl]amino]ethyl]-2-chlorobenzamide |
| SMILES | O=C(NCCNC(=O)c1ccccc1Cl)c1cccc(S(=O)(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C23H22ClN3O4S/c24-21-12-5-4-11-20(21)23(29)26-14-13-25-22(28)18-9-6-10-19(15-18)32(30,31)27-16-17-7-2-1-3-8-17/h1-12,15,27H,13-14,16H2,(H,25,28)(H,26,29) |
| InChIKey | DWTYCCFXVRDOOZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.97 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|