C22H24N4O3 — CID 55659910
N-[(2-cyclopentyloxy-3-pyridinyl)methyl]-3-ethyl-4-oxophthalazine-1-carboxamide (PubChem CID 55659910) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-[(2-cyclopentyloxy-3-pyridinyl)methyl]-3-ethyl-4-oxophthalazine-1-carboxamide.
| Compound Name | N-[(2-cyclopentyloxy-3-pyridinyl)methyl]-3-ethyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 55659910 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N-[(2-cyclopentyloxy-3-pyridinyl)methyl]-3-ethyl-4-oxophthalazine-1-carboxamide |
| SMILES | CCn1nc(C(=O)NCc2cccnc2OC2CCCC2)c2ccccc2c1=O |
| InChI | InChI=1S/C22H24N4O3/c1-2-26-22(28)18-12-6-5-11-17(18)19(25-26)20(27)24-14-15-8-7-13-23-21(15)29-16-9-3-4-10-16/h5-8,11-13,16H,2-4,9-10,14H2,1H3,(H,24,27) |
| InChIKey | SQAQRWUGXJTCJB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |