C20H21F4N3O2S — CID 55661910
(E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-butyl-N-(2,2,2-trifluoroethyl)prop-2-enamide (PubChem CID 55661910) has the molecular formula C20H21F4N3O2S and a molecular weight of 443.47 g/mol. Its IUPAC name is (E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-butyl-N-(2,2,2-trifluoroethyl)prop-2-enamide.
| Compound Name | (E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-butyl-N-(2,2,2-trifluoroethyl)prop-2-enamide |
|---|---|
| PubChem CID | 55661910 |
| Molecular Formula | C20H21F4N3O2S |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | (E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-butyl-N-(2,2,2-trifluoroethyl)prop-2-enamide |
| SMILES | CCCCN(CC(F)(F)F)C(=O)/C=C/c1csc(N(C(C)=O)c2ccccc2F)n1 |
| InChI | InChI=1S/C20H21F4N3O2S/c1-3-4-11-26(13-20(22,23)24)18(29)10-9-15-12-30-19(25-15)27(14(2)28)17-8-6-5-7-16(17)21/h5-10,12H,3-4,11,13H2,1-2H3/b10-9+ |
| InChIKey | VWLGSWKZJCUHDY-MDZDMXLPSA-N |
| XLogP | 5.17 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|