C22H32N2O4 — CID 55662274
[1-(3-ethoxy-4-methoxybenzoyl)piperidin-4-yl]-(3-methylpiperidin-1-yl)methanone (PubChem CID 55662274) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is [1-(3-ethoxy-4-methoxybenzoyl)piperidin-4-yl]-(3-methylpiperidin-1-yl)methanone.
| Compound Name | [1-(3-ethoxy-4-methoxybenzoyl)piperidin-4-yl]-(3-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 55662274 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | [1-(3-ethoxy-4-methoxybenzoyl)piperidin-4-yl]-(3-methylpiperidin-1-yl)methanone |
| SMILES | CCOc1cc(C(=O)N2CCC(C(=O)N3CCCC(C)C3)CC2)ccc1OC |
| InChI | InChI=1S/C22H32N2O4/c1-4-28-20-14-18(7-8-19(20)27-3)22(26)23-12-9-17(10-13-23)21(25)24-11-5-6-16(2)15-24/h7-8,14,16-17H,4-6,9-13,15H2,1-3H3 |
| InChIKey | FYNQAGIIRHHHCK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |