C18H20N6O5S2 — CID 55663261
N-[3-(5-methyltetrazol-1-yl)phenyl]-4-morpholin-4-ylsulfonylbenzenesulfonamide (PubChem CID 55663261) has the molecular formula C18H20N6O5S2 and a molecular weight of 464.53 g/mol. Its IUPAC name is N-[3-(5-methyltetrazol-1-yl)phenyl]-4-morpholin-4-ylsulfonylbenzenesulfonamide.
| Compound Name | N-[3-(5-methyltetrazol-1-yl)phenyl]-4-morpholin-4-ylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 55663261 |
| Molecular Formula | C18H20N6O5S2 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | N-[3-(5-methyltetrazol-1-yl)phenyl]-4-morpholin-4-ylsulfonylbenzenesulfonamide |
| SMILES | Cc1nnnn1-c1cccc(NS(=O)(=O)c2ccc(S(=O)(=O)N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C18H20N6O5S2/c1-14-19-21-22-24(14)16-4-2-3-15(13-16)20-30(25,26)17-5-7-18(8-6-17)31(27,28)23-9-11-29-12-10-23/h2-8,13,20H,9-12H2,1H3 |
| InChIKey | CDUQQKDNDCMSGF-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |