C20H23F3N4O5 — CID 55664217
3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[(2-nitrophenyl)methyl]-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 55664217) has the molecular formula C20H23F3N4O5 and a molecular weight of 456.42 g/mol. Its IUPAC name is 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[(2-nitrophenyl)methyl]-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[(2-nitrophenyl)methyl]-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 55664217 |
| Molecular Formula | C20H23F3N4O5 |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[(2-nitrophenyl)methyl]-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | O=C(CCN1C(=O)NC2(CCCCC2)C1=O)N(Cc1ccccc1[N+](=O)[O-])CC(F)(F)F |
| InChI | InChI=1S/C20H23F3N4O5/c21-20(22,23)13-25(12-14-6-2-3-7-15(14)27(31)32)16(28)8-11-26-17(29)19(24-18(26)30)9-4-1-5-10-19/h2-3,6-7H,1,4-5,8-13H2,(H,24,30) |
| InChIKey | MKGBQJFHWHVTKW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|