About 7-methoxy-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one
7-methoxy-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one (PubChem CID 556647) has the molecular formula C9H10O4
and a molecular weight of 182.18 g/mol. Its IUPAC name is 7-methoxy-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one.
Molecular Properties
| Compound Name | 7-methoxy-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one |
| PubChem CID | 556647 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 7-methoxy-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one |
| SMILES | COC1=CC2(C=CC1=O)OCCO2 |
| InChI | InChI=1S/C9H10O4/c1-11-8-6-9(3-2-7(8)10)12-4-5-13-9/h2-3,6H,4-5H2,1H3 |
| InChIKey | SZUVNRDRLZONOB-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-methoxy-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one?
The IUPAC name of 7-methoxy-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one (CID 556647) is 7-methoxy-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one.
What is the SMILES notation for 7-methoxy-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one?
The canonical SMILES for 7-methoxy-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one is COC1=CC2(C=CC1=O)OCCO2.
What is the InChIKey of 7-methoxy-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one?
The InChIKey is SZUVNRDRLZONOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O4/c1-11-8-6-9(3-2-7(8)10)12-4-5-13-9/h2-3,6H,4-5H2,1H3.
What are the key properties of 7-methoxy-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one?
7-methoxy-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one has a molecular weight of 182.18 g/mol, XLogP of 0.40, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one is sourced from PubChem (CID 556647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).