C10Cl8N2S2 — CID 556658
2,3,4,5-tetrachloro-6-[(3,4,5,6-tetrachloro-2-pyridinyl)disulfanyl]pyridine (PubChem CID 556658) has the molecular formula C10Cl8N2S2 and a molecular weight of 495.88 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[(3,4,5,6-tetrachloro-2-pyridinyl)disulfanyl]pyridine.
| Compound Name | 2,3,4,5-tetrachloro-6-[(3,4,5,6-tetrachloro-2-pyridinyl)disulfanyl]pyridine |
|---|---|
| PubChem CID | 556658 |
| Molecular Formula | C10Cl8N2S2 |
| Molecular Weight | 495.88 g/mol |
| Exact Mass | 491.70 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[(3,4,5,6-tetrachloro-2-pyridinyl)disulfanyl]pyridine |
| SMILES | Clc1nc(SSc2nc(Cl)c(Cl)c(Cl)c2Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C10Cl8N2S2/c11-1-3(13)7(17)19-9(5(1)15)21-22-10-6(16)2(12)4(14)8(18)20-10 |
| InChIKey | ZCWPPTRLOQMXGD-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.88 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|