C20H18FNO3S — CID 55667253
(2-ethoxyphenyl) 2-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 55667253) has the molecular formula C20H18FNO3S and a molecular weight of 371.43 g/mol. Its IUPAC name is (2-ethoxyphenyl) 2-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | (2-ethoxyphenyl) 2-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 55667253 |
| Molecular Formula | C20H18FNO3S |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | (2-ethoxyphenyl) 2-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOc1ccccc1OC(=O)c1sc(Cc2ccc(F)cc2)nc1C |
| InChI | InChI=1S/C20H18FNO3S/c1-3-24-16-6-4-5-7-17(16)25-20(23)19-13(2)22-18(26-19)12-14-8-10-15(21)11-9-14/h4-11H,3,12H2,1-2H3 |
| InChIKey | LPGKZWQCVFEBRO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|