C20H15N7O5 — CID 55668470
N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]-1-(3-nitrophenyl)pyrazole-3-carboxamide (PubChem CID 55668470) has the molecular formula C20H15N7O5 and a molecular weight of 433.38 g/mol. Its IUPAC name is N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]-1-(3-nitrophenyl)pyrazole-3-carboxamide.
| Compound Name | N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]-1-(3-nitrophenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55668470 |
| Molecular Formula | C20H15N7O5 |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]-1-(3-nitrophenyl)pyrazole-3-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccn(-c3cccc([N+](=O)[O-])c3)n2)n(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C20H15N7O5/c1-13-11-19(25(22-13)14-5-7-15(8-6-14)26(29)30)21-20(28)18-9-10-24(23-18)16-3-2-4-17(12-16)27(31)32/h2-12H,1H3,(H,21,28) |
| InChIKey | UKLCUYBIBHYINJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 151.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|