C18H19N3O5S — CID 55668860
N-[4-[methoxy(methyl)sulfamoyl]phenyl]-3-phenyl-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 55668860) has the molecular formula C18H19N3O5S and a molecular weight of 389.43 g/mol. Its IUPAC name is N-[4-[methoxy(methyl)sulfamoyl]phenyl]-3-phenyl-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | N-[4-[methoxy(methyl)sulfamoyl]phenyl]-3-phenyl-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 55668860 |
| Molecular Formula | C18H19N3O5S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | N-[4-[methoxy(methyl)sulfamoyl]phenyl]-3-phenyl-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | CON(C)S(=O)(=O)c1ccc(NC(=O)C2CC(c3ccccc3)=NO2)cc1 |
| InChI | InChI=1S/C18H19N3O5S/c1-21(25-2)27(23,24)15-10-8-14(9-11-15)19-18(22)17-12-16(20-26-17)13-6-4-3-5-7-13/h3-11,17H,12H2,1-2H3,(H,19,22) |
| InChIKey | UIZUEHZHLVKXFE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|