C20H28N6O3 — CID 55669128
2-[4-[1-(3-methoxyphenyl)-5-methyltriazole-4-carbonyl]piperazin-1-yl]-N-propylacetamide (PubChem CID 55669128) has the molecular formula C20H28N6O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-[4-[1-(3-methoxyphenyl)-5-methyltriazole-4-carbonyl]piperazin-1-yl]-N-propylacetamide.
| Compound Name | 2-[4-[1-(3-methoxyphenyl)-5-methyltriazole-4-carbonyl]piperazin-1-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 55669128 |
| Molecular Formula | C20H28N6O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 2-[4-[1-(3-methoxyphenyl)-5-methyltriazole-4-carbonyl]piperazin-1-yl]-N-propylacetamide |
| SMILES | CCCNC(=O)CN1CCN(C(=O)c2nnn(-c3cccc(OC)c3)c2C)CC1 |
| InChI | InChI=1S/C20H28N6O3/c1-4-8-21-18(27)14-24-9-11-25(12-10-24)20(28)19-15(2)26(23-22-19)16-6-5-7-17(13-16)29-3/h5-7,13H,4,8-12,14H2,1-3H3,(H,21,27) |
| InChIKey | NGKFCJNBKOWSFS-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |