C23H27FN2O6S — CID 55669482
ethyl 4-[4-[(3-fluoro-4-methoxyphenyl)methylcarbamoyl]piperidin-1-yl]sulfonylbenzoate (PubChem CID 55669482) has the molecular formula C23H27FN2O6S and a molecular weight of 478.54 g/mol. Its IUPAC name is ethyl 4-[4-[(3-fluoro-4-methoxyphenyl)methylcarbamoyl]piperidin-1-yl]sulfonylbenzoate.
| Compound Name | ethyl 4-[4-[(3-fluoro-4-methoxyphenyl)methylcarbamoyl]piperidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 55669482 |
| Molecular Formula | C23H27FN2O6S |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | ethyl 4-[4-[(3-fluoro-4-methoxyphenyl)methylcarbamoyl]piperidin-1-yl]sulfonylbenzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCC(C(=O)NCc3ccc(OC)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C23H27FN2O6S/c1-3-32-23(28)18-5-7-19(8-6-18)33(29,30)26-12-10-17(11-13-26)22(27)25-15-16-4-9-21(31-2)20(24)14-16/h4-9,14,17H,3,10-13,15H2,1-2H3,(H,25,27) |
| InChIKey | JUQJKBDIDDSLBC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |