C22H20Cl2N4O3 — CID 55669948
N-(3,4-dichlorophenyl)-1-[2-(4-oxocinnolin-1-yl)acetyl]piperidine-2-carboxamide (PubChem CID 55669948) has the molecular formula C22H20Cl2N4O3 and a molecular weight of 459.33 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-1-[2-(4-oxocinnolin-1-yl)acetyl]piperidine-2-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-1-[2-(4-oxocinnolin-1-yl)acetyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 55669948 |
| Molecular Formula | C22H20Cl2N4O3 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | N-(3,4-dichlorophenyl)-1-[2-(4-oxocinnolin-1-yl)acetyl]piperidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)C1CCCCN1C(=O)Cn1ncc(=O)c2ccccc21 |
| InChI | InChI=1S/C22H20Cl2N4O3/c23-16-9-8-14(11-17(16)24)26-22(31)19-7-3-4-10-27(19)21(30)13-28-18-6-2-1-5-15(18)20(29)12-25-28/h1-2,5-6,8-9,11-12,19H,3-4,7,10,13H2,(H,26,31) |
| InChIKey | GROLLWGPJBKSDH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |