C20H20Cl2N4O4S — CID 55669970
N-(3,4-dichlorophenyl)-1-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carbonyl)piperidine-2-carboxamide (PubChem CID 55669970) has the molecular formula C20H20Cl2N4O4S and a molecular weight of 483.38 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-1-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carbonyl)piperidine-2-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-1-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carbonyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 55669970 |
| Molecular Formula | C20H20Cl2N4O4S |
| Molecular Weight | 483.38 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | N-(3,4-dichlorophenyl)-1-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carbonyl)piperidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)C1CCCCN1C(=O)C1=CC=CN2CCS(=O)(=O)N=C12 |
| InChI | InChI=1S/C20H20Cl2N4O4S/c21-15-7-6-13(12-16(15)22)23-19(27)17-5-1-2-9-26(17)20(28)14-4-3-8-25-10-11-31(29,30)24-18(14)25/h3-4,6-8,12,17H,1-2,5,9-11H2,(H,23,27) |
| InChIKey | IWRDXEBSJJNTHJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |