About 3-(5,7-difluoro-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one
3-(5,7-difluoro-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one (PubChem CID 55671680) has the molecular formula C20H17F2NO3
and a molecular weight of 357.36 g/mol. Its IUPAC name is 3-(5,7-difluoro-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one.
Molecular Properties
| Compound Name | 3-(5,7-difluoro-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one |
| PubChem CID | 55671680 |
| Molecular Formula | C20H17F2NO3 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 3-(5,7-difluoro-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one |
| SMILES | CC1(C(=O)N2CCCc3c(F)cc(F)cc32)Cc2ccccc2C(=O)O1 |
| InChI | InChI=1S/C20H17F2NO3/c1-20(11-12-5-2-3-6-14(12)18(24)26-20)19(25)23-8-4-7-15-16(22)9-13(21)10-17(15)23/h2-3,5-6,9-10H,4,7-8,11H2,1H3 |
| InChIKey | ULNHHKVTNXTTKW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(5,7-difluoro-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5,7-difluoro-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one?
The IUPAC name of 3-(5,7-difluoro-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one (CID 55671680) is 3-(5,7-difluoro-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one.
What is the SMILES notation for 3-(5,7-difluoro-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one?
The canonical SMILES for 3-(5,7-difluoro-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one is CC1(C(=O)N2CCCc3c(F)cc(F)cc32)Cc2ccccc2C(=O)O1.
What is the InChIKey of 3-(5,7-difluoro-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one?
The InChIKey is ULNHHKVTNXTTKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17F2NO3/c1-20(11-12-5-2-3-6-14(12)18(24)26-20)19(25)23-8-4-7-15-16(22)9-13(21)10-17(15)23/h2-3,5-6,9-10H,4,7-8,11H2,1H3.
What are the key properties of 3-(5,7-difluoro-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one?
3-(5,7-difluoro-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one has a molecular weight of 357.36 g/mol, XLogP of 3.42, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5,7-difluoro-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one is sourced from PubChem (CID 55671680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).