C22H24N6O5 — CID 55672280
6-methyl-N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cycloheptyl]-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide (PubChem CID 55672280) has the molecular formula C22H24N6O5 and a molecular weight of 452.47 g/mol. Its IUPAC name is 6-methyl-N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cycloheptyl]-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide.
| Compound Name | 6-methyl-N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cycloheptyl]-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 55672280 |
| Molecular Formula | C22H24N6O5 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 6-methyl-N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cycloheptyl]-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide |
| SMILES | Cc1nc(C2(NC(=O)c3nn(-c4ccccc4[N+](=O)[O-])c(C)cc3=O)CCCCCC2)no1 |
| InChI | InChI=1S/C22H24N6O5/c1-14-13-18(29)19(25-27(14)16-9-5-6-10-17(16)28(31)32)20(30)24-22(11-7-3-4-8-12-22)21-23-15(2)33-26-21/h5-6,9-10,13H,3-4,7-8,11-12H2,1-2H3,(H,24,30) |
| InChIKey | CXLVTTABVTYWFU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|