C19H19ClN6O2 — CID 55673413
2-chloro-N,N-diethyl-4-[[2-(tetrazol-1-yl)benzoyl]amino]benzamide (PubChem CID 55673413) has the molecular formula C19H19ClN6O2 and a molecular weight of 398.85 g/mol. Its IUPAC name is 2-chloro-N,N-diethyl-4-[[2-(tetrazol-1-yl)benzoyl]amino]benzamide.
| Compound Name | 2-chloro-N,N-diethyl-4-[[2-(tetrazol-1-yl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 55673413 |
| Molecular Formula | C19H19ClN6O2 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 2-chloro-N,N-diethyl-4-[[2-(tetrazol-1-yl)benzoyl]amino]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)c2ccccc2-n2cnnn2)cc1Cl |
| InChI | InChI=1S/C19H19ClN6O2/c1-3-25(4-2)19(28)14-10-9-13(11-16(14)20)22-18(27)15-7-5-6-8-17(15)26-12-21-23-24-26/h5-12H,3-4H2,1-2H3,(H,22,27) |
| InChIKey | NEVPPCNVSJEEOK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |