C20H25Cl2N3O5 — CID 55673573
ethyl N-[1-[2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoylamino]-4-methylpentan-2-yl]carbamate (PubChem CID 55673573) has the molecular formula C20H25Cl2N3O5 and a molecular weight of 458.34 g/mol. Its IUPAC name is ethyl N-[1-[2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoylamino]-4-methylpentan-2-yl]carbamate.
| Compound Name | ethyl N-[1-[2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoylamino]-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 55673573 |
| Molecular Formula | C20H25Cl2N3O5 |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | ethyl N-[1-[2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoylamino]-4-methylpentan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(CNC(=O)C(C)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O)CC(C)C |
| InChI | InChI=1S/C20H25Cl2N3O5/c1-5-30-20(29)24-12(6-10(2)3)9-23-17(26)11(4)25-18(27)13-7-15(21)16(22)8-14(13)19(25)28/h7-8,10-12H,5-6,9H2,1-4H3,(H,23,26)(H,24,29) |
| InChIKey | BMOQAHYBHOKKMT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|