C18H15ClN2O4 — CID 55675140
5-chloro-N-[6-(2-methoxy-4-methylphenoxy)-3-pyridinyl]furan-2-carboxamide (PubChem CID 55675140) has the molecular formula C18H15ClN2O4 and a molecular weight of 358.78 g/mol. Its IUPAC name is 5-chloro-N-[6-(2-methoxy-4-methylphenoxy)-3-pyridinyl]furan-2-carboxamide.
| Compound Name | 5-chloro-N-[6-(2-methoxy-4-methylphenoxy)-3-pyridinyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55675140 |
| Molecular Formula | C18H15ClN2O4 |
| Molecular Weight | 358.78 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 5-chloro-N-[6-(2-methoxy-4-methylphenoxy)-3-pyridinyl]furan-2-carboxamide |
| SMILES | COc1cc(C)ccc1Oc1ccc(NC(=O)c2ccc(Cl)o2)cn1 |
| InChI | InChI=1S/C18H15ClN2O4/c1-11-3-5-13(15(9-11)23-2)25-17-8-4-12(10-20-17)21-18(22)14-6-7-16(19)24-14/h3-10H,1-2H3,(H,21,22) |
| InChIKey | NWHYHDGFUDRNMC-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.78 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |