C23H28N4OS — CID 55675685
(1,3-dimethyl-6-thiophen-2-ylpyrazolo[5,4-b]pyridin-4-yl)-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)methanone (PubChem CID 55675685) has the molecular formula C23H28N4OS and a molecular weight of 408.57 g/mol. Its IUPAC name is (1,3-dimethyl-6-thiophen-2-ylpyrazolo[5,4-b]pyridin-4-yl)-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)methanone.
| Compound Name | (1,3-dimethyl-6-thiophen-2-ylpyrazolo[5,4-b]pyridin-4-yl)-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)methanone |
|---|---|
| PubChem CID | 55675685 |
| Molecular Formula | C23H28N4OS |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (1,3-dimethyl-6-thiophen-2-ylpyrazolo[5,4-b]pyridin-4-yl)-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)methanone |
| SMILES | Cc1nn(C)c2nc(-c3cccs3)cc(C(=O)N3CCC(C)C4CCCCC43)c12 |
| InChI | InChI=1S/C23H28N4OS/c1-14-10-11-27(19-8-5-4-7-16(14)19)23(28)17-13-18(20-9-6-12-29-20)24-22-21(17)15(2)25-26(22)3/h6,9,12-14,16,19H,4-5,7-8,10-11H2,1-3H3 |
| InChIKey | POSBAIXYPHBKDC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |