C23H24N4O2 — CID 55676948
N-[2-(3,5-dimethylpiperidine-1-carbonyl)phenyl]quinoxaline-2-carboxamide (PubChem CID 55676948) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[2-(3,5-dimethylpiperidine-1-carbonyl)phenyl]quinoxaline-2-carboxamide.
| Compound Name | N-[2-(3,5-dimethylpiperidine-1-carbonyl)phenyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 55676948 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | N-[2-(3,5-dimethylpiperidine-1-carbonyl)phenyl]quinoxaline-2-carboxamide |
| SMILES | CC1CC(C)CN(C(=O)c2ccccc2NC(=O)c2cnc3ccccc3n2)C1 |
| InChI | InChI=1S/C23H24N4O2/c1-15-11-16(2)14-27(13-15)23(29)17-7-3-4-8-18(17)26-22(28)21-12-24-19-9-5-6-10-20(19)25-21/h3-10,12,15-16H,11,13-14H2,1-2H3,(H,26,28) |
| InChIKey | NQSIIINELUATKN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |