C17H24N4O5 — CID 55678363
N-[3-(2-methoxyethoxy)propyl]-2,4-dioxo-1-propylpyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 55678363) has the molecular formula C17H24N4O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is N-[3-(2-methoxyethoxy)propyl]-2,4-dioxo-1-propylpyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-[3-(2-methoxyethoxy)propyl]-2,4-dioxo-1-propylpyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 55678363 |
| Molecular Formula | C17H24N4O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | N-[3-(2-methoxyethoxy)propyl]-2,4-dioxo-1-propylpyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CCCn1c(=O)[nH]c(=O)c2cc(C(=O)NCCCOCCOC)cnc21 |
| InChI | InChI=1S/C17H24N4O5/c1-3-6-21-14-13(16(23)20-17(21)24)10-12(11-19-14)15(22)18-5-4-7-26-9-8-25-2/h10-11H,3-9H2,1-2H3,(H,18,22)(H,20,23,24) |
| InChIKey | BAKFIPMVDATNPZ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|