C21H19Cl2FN2O2 — CID 55678963
(E)-3-(2,6-dichlorophenyl)-1-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 55678963) has the molecular formula C21H19Cl2FN2O2 and a molecular weight of 421.30 g/mol. Its IUPAC name is (E)-3-(2,6-dichlorophenyl)-1-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2,6-dichlorophenyl)-1-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 55678963 |
| Molecular Formula | C21H19Cl2FN2O2 |
| Molecular Weight | 421.30 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | (E)-3-(2,6-dichlorophenyl)-1-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1c(Cl)cccc1Cl)N1CCN(C(=O)Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H19Cl2FN2O2/c22-18-2-1-3-19(23)17(18)8-9-20(27)25-10-12-26(13-11-25)21(28)14-15-4-6-16(24)7-5-15/h1-9H,10-14H2/b9-8+ |
| InChIKey | HMTVSYIHSCREDU-CMDGGOBGSA-N |
| XLogP | 4.06 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.30 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|