C15H22N6O3S — CID 55680997
2-[4-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]piperidin-1-yl]-N-propylacetamide (PubChem CID 55680997) has the molecular formula C15H22N6O3S and a molecular weight of 366.45 g/mol. Its IUPAC name is 2-[4-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]piperidin-1-yl]-N-propylacetamide.
| Compound Name | 2-[4-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]piperidin-1-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 55680997 |
| Molecular Formula | C15H22N6O3S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-[4-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]piperidin-1-yl]-N-propylacetamide |
| SMILES | CCCNC(=O)CN1CCC(Nc2nc3sccn3c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H22N6O3S/c1-2-5-16-12(22)10-19-6-3-11(4-7-19)17-13-14(21(23)24)20-8-9-25-15(20)18-13/h8-9,11,17H,2-7,10H2,1H3,(H,16,22) |
| InChIKey | GLIRLKQNOHGSRG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|