C23H29N5S — CID 55681245
2-[[cyclopropyl-[(4-ethylphenyl)methyl]amino]methyl]-4-propyl-5-pyridin-4-yl-1,2,4-triazole-3-thione (PubChem CID 55681245) has the molecular formula C23H29N5S and a molecular weight of 407.59 g/mol. Its IUPAC name is 2-[[cyclopropyl-[(4-ethylphenyl)methyl]amino]methyl]-4-propyl-5-pyridin-4-yl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[cyclopropyl-[(4-ethylphenyl)methyl]amino]methyl]-4-propyl-5-pyridin-4-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 55681245 |
| Molecular Formula | C23H29N5S |
| Molecular Weight | 407.59 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 2-[[cyclopropyl-[(4-ethylphenyl)methyl]amino]methyl]-4-propyl-5-pyridin-4-yl-1,2,4-triazole-3-thione |
| SMILES | CCCn1c(-c2ccncc2)nn(CN(Cc2ccc(CC)cc2)C2CC2)c1=S |
| InChI | InChI=1S/C23H29N5S/c1-3-15-27-22(20-11-13-24-14-12-20)25-28(23(27)29)17-26(21-9-10-21)16-19-7-5-18(4-2)6-8-19/h5-8,11-14,21H,3-4,9-10,15-17H2,1-2H3 |
| InChIKey | GMVIXRATZQLQKT-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|