About (2-oxo-4-propylchromen-7-yl) 6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfonate
(2-oxo-4-propylchromen-7-yl) 6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfonate (PubChem CID 55682437) has the molecular formula C20H16ClNO7S
and a molecular weight of 449.87 g/mol. Its IUPAC name is (2-oxo-4-propylchromen-7-yl) 6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfonate.
Molecular Properties
| Compound Name | (2-oxo-4-propylchromen-7-yl) 6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfonate |
| PubChem CID | 55682437 |
| Molecular Formula | C20H16ClNO7S |
| Molecular Weight | 449.87 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | (2-oxo-4-propylchromen-7-yl) 6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfonate |
| SMILES | CCCc1cc(=O)oc2cc(OS(=O)(=O)c3cc4c(cc3Cl)NC(=O)CO4)ccc12 |
| InChI | InChI=1S/C20H16ClNO7S/c1-2-3-11-6-20(24)28-16-7-12(4-5-13(11)16)29-30(25,26)18-9-17-15(8-14(18)21)22-19(23)10-27-17/h4-9H,2-3,10H2,1H3,(H,22,23) |
| InChIKey | BMRMGDJQZSXSHW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.87 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-oxo-4-propylchromen-7-yl) 6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-4-propylchromen-7-yl) 6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfonate?
The IUPAC name of (2-oxo-4-propylchromen-7-yl) 6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfonate (CID 55682437) is (2-oxo-4-propylchromen-7-yl) 6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfonate.
What is the SMILES notation for (2-oxo-4-propylchromen-7-yl) 6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfonate?
The canonical SMILES for (2-oxo-4-propylchromen-7-yl) 6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfonate is CCCc1cc(=O)oc2cc(OS(=O)(=O)c3cc4c(cc3Cl)NC(=O)CO4)ccc12.
What is the InChIKey of (2-oxo-4-propylchromen-7-yl) 6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfonate?
The InChIKey is BMRMGDJQZSXSHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16ClNO7S/c1-2-3-11-6-20(24)28-16-7-12(4-5-13(11)16)29-30(25,26)18-9-17-15(8-14(18)21)22-19(23)10-27-17/h4-9H,2-3,10H2,1H3,(H,22,23).
What are the key properties of (2-oxo-4-propylchromen-7-yl) 6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfonate?
(2-oxo-4-propylchromen-7-yl) 6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfonate has a molecular weight of 449.87 g/mol, XLogP of 3.50, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-4-propylchromen-7-yl) 6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfonate is sourced from PubChem (CID 55682437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).