C25H27N5O3S — CID 55683851
N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]-5-oxo-1-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 55683851) has the molecular formula C25H27N5O3S and a molecular weight of 477.59 g/mol. Its IUPAC name is N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]-5-oxo-1-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]-5-oxo-1-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55683851 |
| Molecular Formula | C25H27N5O3S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]-5-oxo-1-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | CC(=O)NCCCc1ccc(-c2csc(NC(=O)C3CC(=O)N(Cc4ccccn4)C3)n2)cc1 |
| InChI | InChI=1S/C25H27N5O3S/c1-17(31)26-12-4-5-18-7-9-19(10-8-18)22-16-34-25(28-22)29-24(33)20-13-23(32)30(14-20)15-21-6-2-3-11-27-21/h2-3,6-11,16,20H,4-5,12-15H2,1H3,(H,26,31)(H,28,29,33) |
| InChIKey | QBUSZZZUINKXRN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|