C17H21Cl2N3O — CID 55684076
N-[[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]methyl]-2-(oxolan-2-yl)ethanamine (PubChem CID 55684076) has the molecular formula C17H21Cl2N3O and a molecular weight of 354.28 g/mol. Its IUPAC name is N-[[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]methyl]-2-(oxolan-2-yl)ethanamine.
| Compound Name | N-[[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]methyl]-2-(oxolan-2-yl)ethanamine |
|---|---|
| PubChem CID | 55684076 |
| Molecular Formula | C17H21Cl2N3O |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | N-[[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]methyl]-2-(oxolan-2-yl)ethanamine |
| SMILES | Cc1nn(-c2cccc(Cl)c2)c(Cl)c1CNCCC1CCCO1 |
| InChI | InChI=1S/C17H21Cl2N3O/c1-12-16(11-20-8-7-15-6-3-9-23-15)17(19)22(21-12)14-5-2-4-13(18)10-14/h2,4-5,10,15,20H,3,6-9,11H2,1H3 |
| InChIKey | VCRXTMDLQAEFPP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|