C17H17Cl2NO3 — CID 55686865
2-(2,3-dichlorophenoxy)-N-(2-phenoxyethyl)propanamide (PubChem CID 55686865) has the molecular formula C17H17Cl2NO3 and a molecular weight of 354.23 g/mol. Its IUPAC name is 2-(2,3-dichlorophenoxy)-N-(2-phenoxyethyl)propanamide.
| Compound Name | 2-(2,3-dichlorophenoxy)-N-(2-phenoxyethyl)propanamide |
|---|---|
| PubChem CID | 55686865 |
| Molecular Formula | C17H17Cl2NO3 |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 2-(2,3-dichlorophenoxy)-N-(2-phenoxyethyl)propanamide |
| SMILES | CC(Oc1cccc(Cl)c1Cl)C(=O)NCCOc1ccccc1 |
| InChI | InChI=1S/C17H17Cl2NO3/c1-12(23-15-9-5-8-14(18)16(15)19)17(21)20-10-11-22-13-6-3-2-4-7-13/h2-9,12H,10-11H2,1H3,(H,20,21) |
| InChIKey | YBZAKXPDICNCKO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|