About N-[2-(diethylamino)-2-phenylethyl]-4-(5-phenyl-1,3-oxazol-2-yl)butanamide
N-[2-(diethylamino)-2-phenylethyl]-4-(5-phenyl-1,3-oxazol-2-yl)butanamide (PubChem CID 55686875) has the molecular formula C25H31N3O2
and a molecular weight of 405.54 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-phenylethyl]-4-(5-phenyl-1,3-oxazol-2-yl)butanamide.
Molecular Properties
| Compound Name | N-[2-(diethylamino)-2-phenylethyl]-4-(5-phenyl-1,3-oxazol-2-yl)butanamide |
| PubChem CID | 55686875 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | N-[2-(diethylamino)-2-phenylethyl]-4-(5-phenyl-1,3-oxazol-2-yl)butanamide |
| SMILES | CCN(CC)C(CNC(=O)CCCc1ncc(-c2ccccc2)o1)c1ccccc1 |
| InChI | InChI=1S/C25H31N3O2/c1-3-28(4-2)22(20-12-7-5-8-13-20)18-26-24(29)16-11-17-25-27-19-23(30-25)21-14-9-6-10-15-21/h5-10,12-15,19,22H,3-4,11,16-18H2,1-2H3,(H,26,29) |
| InChIKey | ROGWIMINHMVJJO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(diethylamino)-2-phenylethyl]-4-(5-phenyl-1,3-oxazol-2-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(diethylamino)-2-phenylethyl]-4-(5-phenyl-1,3-oxazol-2-yl)butanamide?
The IUPAC name of N-[2-(diethylamino)-2-phenylethyl]-4-(5-phenyl-1,3-oxazol-2-yl)butanamide (CID 55686875) is N-[2-(diethylamino)-2-phenylethyl]-4-(5-phenyl-1,3-oxazol-2-yl)butanamide.
What is the SMILES notation for N-[2-(diethylamino)-2-phenylethyl]-4-(5-phenyl-1,3-oxazol-2-yl)butanamide?
The canonical SMILES for N-[2-(diethylamino)-2-phenylethyl]-4-(5-phenyl-1,3-oxazol-2-yl)butanamide is CCN(CC)C(CNC(=O)CCCc1ncc(-c2ccccc2)o1)c1ccccc1.
What is the InChIKey of N-[2-(diethylamino)-2-phenylethyl]-4-(5-phenyl-1,3-oxazol-2-yl)butanamide?
The InChIKey is ROGWIMINHMVJJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H31N3O2/c1-3-28(4-2)22(20-12-7-5-8-13-20)18-26-24(29)16-11-17-25-27-19-23(30-25)21-14-9-6-10-15-21/h5-10,12-15,19,22H,3-4,11,16-18H2,1-2H3,(H,26,29).
What are the key properties of N-[2-(diethylamino)-2-phenylethyl]-4-(5-phenyl-1,3-oxazol-2-yl)butanamide?
N-[2-(diethylamino)-2-phenylethyl]-4-(5-phenyl-1,3-oxazol-2-yl)butanamide has a molecular weight of 405.54 g/mol, XLogP of 4.86, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(diethylamino)-2-phenylethyl]-4-(5-phenyl-1,3-oxazol-2-yl)butanamide is sourced from PubChem (CID 55686875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).