About 1,2-dioctylcyclopropene
1,2-dioctylcyclopropene (PubChem CID 556893) has the molecular formula C19H36
and a molecular weight of 264.50 g/mol. Its IUPAC name is 1,2-dioctylcyclopropene.
Molecular Properties
| Compound Name | 1,2-dioctylcyclopropene |
| PubChem CID | 556893 |
| Molecular Formula | C19H36 |
| Molecular Weight | 264.50 g/mol |
| Exact Mass | 264.28 |
| IUPAC Name | 1,2-dioctylcyclopropene |
| SMILES | CCCCCCCCC1=C(CCCCCCCC)C1 |
| InChI | InChI=1S/C19H36/c1-3-5-7-9-11-13-15-18-17-19(18)16-14-12-10-8-6-4-2/h3-17H2,1-2H3 |
| InChIKey | YDYRZYFCIFBMMN-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.50 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dioctylcyclopropene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dioctylcyclopropene?
The IUPAC name of 1,2-dioctylcyclopropene (CID 556893) is 1,2-dioctylcyclopropene.
What is the SMILES notation for 1,2-dioctylcyclopropene?
The canonical SMILES for 1,2-dioctylcyclopropene is CCCCCCCCC1=C(CCCCCCCC)C1.
What is the InChIKey of 1,2-dioctylcyclopropene?
The InChIKey is YDYRZYFCIFBMMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36/c1-3-5-7-9-11-13-15-18-17-19(18)16-14-12-10-8-6-4-2/h3-17H2,1-2H3.
What are the key properties of 1,2-dioctylcyclopropene?
1,2-dioctylcyclopropene has a molecular weight of 264.50 g/mol, XLogP of 7.19, 14 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dioctylcyclopropene is sourced from PubChem (CID 556893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).