C24H25N5O2S — CID 55691033
N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanamide (PubChem CID 55691033) has the molecular formula C24H25N5O2S and a molecular weight of 447.56 g/mol. Its IUPAC name is N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanamide.
| Compound Name | N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanamide |
|---|---|
| PubChem CID | 55691033 |
| Molecular Formula | C24H25N5O2S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanamide |
| SMILES | O=C(CCCc1nc(-c2cccs2)no1)NC1CCCc2c1cnn2Cc1ccccc1 |
| InChI | InChI=1S/C24H25N5O2S/c30-22(12-5-13-23-27-24(28-31-23)21-11-6-14-32-21)26-19-9-4-10-20-18(19)15-25-29(20)16-17-7-2-1-3-8-17/h1-3,6-8,11,14-15,19H,4-5,9-10,12-13,16H2,(H,26,30) |
| InChIKey | JUQPIKSRRPPYBM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |