C22H20ClN3O3 — CID 55691668
N'-(2-chlorobenzoyl)-3,5-dimethyl-4-(pyridin-3-ylmethoxy)benzohydrazide (PubChem CID 55691668) has the molecular formula C22H20ClN3O3 and a molecular weight of 409.87 g/mol. Its IUPAC name is N'-(2-chlorobenzoyl)-3,5-dimethyl-4-(pyridin-3-ylmethoxy)benzohydrazide.
| Compound Name | N'-(2-chlorobenzoyl)-3,5-dimethyl-4-(pyridin-3-ylmethoxy)benzohydrazide |
|---|---|
| PubChem CID | 55691668 |
| Molecular Formula | C22H20ClN3O3 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | N'-(2-chlorobenzoyl)-3,5-dimethyl-4-(pyridin-3-ylmethoxy)benzohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2ccccc2Cl)cc(C)c1OCc1cccnc1 |
| InChI | InChI=1S/C22H20ClN3O3/c1-14-10-17(11-15(2)20(14)29-13-16-6-5-9-24-12-16)21(27)25-26-22(28)18-7-3-4-8-19(18)23/h3-12H,13H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | OPMJCFHHKGMGPR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|