C21H18ClFN2O2S — CID 55692937
2-[(4-chlorophenyl)methylsulfanyl]-N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]acetamide (PubChem CID 55692937) has the molecular formula C21H18ClFN2O2S and a molecular weight of 416.91 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfanyl]-N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]acetamide.
| Compound Name | 2-[(4-chlorophenyl)methylsulfanyl]-N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]acetamide |
|---|---|
| PubChem CID | 55692937 |
| Molecular Formula | C21H18ClFN2O2S |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfanyl]-N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]acetamide |
| SMILES | O=C(CSCc1ccc(Cl)cc1)NCc1cccnc1Oc1cccc(F)c1 |
| InChI | InChI=1S/C21H18ClFN2O2S/c22-17-8-6-15(7-9-17)13-28-14-20(26)25-12-16-3-2-10-24-21(16)27-19-5-1-4-18(23)11-19/h1-11H,12-14H2,(H,25,26) |
| InChIKey | QTZBQRWMLCGLRM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |